ChemNet > CAS > 118337-33-0 2-brom-1-(3-methylbenzo[b]thiofen-2-yl)ethan-1-on
118337-33-0 2-brom-1-(3-methylbenzo[b]thiofen-2-yl)ethan-1-on
| název výrobku |
2-brom-1-(3-methylbenzo[b]thiofen-2-yl)ethan-1-on |
| Synonyma |
2-brom-1-(3-methyl-1-benzothiofen-2-yl)ethan; 2-brom-1-(5-chlor-3-methyl-1-benzothiofen-2-yl)ethan |
| Anglický název |
2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one;2-bromo-1-(3-methyl-1-benzothiophen-2-yl)ethanone; 2-bromo-1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethanone |
| Molekulární vzorec |
C11H8BrClOS |
| Molekulová hmotnost |
303.6026 |
| InChI |
InChI=1/C11H8BrClOS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3 |
| Registrační číslo CAS |
118337-33-0 |
| Molekulární struktura |
|
| Hustota |
1.632g/cm3 |
| Bod tání |
94℃ |
| Bod varu |
396.2°C at 760 mmHg |
| Index lomu |
1.676 |
| Bod vzplanutí |
193.4°C |
| Tlak par |
1.73E-06mmHg at 25°C |
| Symbolů nebezpečnosti |
C:Corrosive;
|
| Riziko Codes |
R34:Causes burns.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|